C22H18Cl2N4O3S2 — CID 2413997
N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide (PubChem CID 2413997) has the molecular formula C22H18Cl2N4O3S2 and a molecular weight of 521.45 g/mol. Its IUPAC name is N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide.
| Compound Name | N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 2413997 |
| Molecular Formula | C22H18Cl2N4O3S2 |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 520.02 |
| IUPAC Name | N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide |
| SMILES | Cc1noc(C)c1COc1cccc(C(=O)Nc2nnc(SCc3c(Cl)cccc3Cl)s2)c1 |
| InChI | InChI=1S/C22H18Cl2N4O3S2/c1-12-16(13(2)31-28-12)10-30-15-6-3-5-14(9-15)20(29)25-21-26-27-22(33-21)32-11-17-18(23)7-4-8-19(17)24/h3-9H,10-11H2,1-2H3,(H,25,26,29) |
| InChIKey | HCAVPEMNDXMHNG-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|