C16H12Cl2N4O2S2 — CID 134056656
N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-methoxypyridine-3-carboxamide (PubChem CID 134056656) has the molecular formula C16H12Cl2N4O2S2 and a molecular weight of 427.34 g/mol. Its IUPAC name is N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-methoxypyridine-3-carboxamide.
| Compound Name | N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 134056656 |
| Molecular Formula | C16H12Cl2N4O2S2 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-methoxypyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2nnc(SCc3c(Cl)cccc3Cl)s2)cn1 |
| InChI | InChI=1S/C16H12Cl2N4O2S2/c1-24-13-6-5-9(7-19-13)14(23)20-15-21-22-16(26-15)25-8-10-11(17)3-2-4-12(10)18/h2-7H,8H2,1H3,(H,20,21,23) |
| InChIKey | DPAVGPFGKMJLDL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|