C16H12Cl2N4OS2 — CID 31920680
N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-methylpyridine-2-carboxamide (PubChem CID 31920680) has the molecular formula C16H12Cl2N4OS2 and a molecular weight of 411.34 g/mol. Its IUPAC name is N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-methylpyridine-2-carboxamide.
| Compound Name | N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 31920680 |
| Molecular Formula | C16H12Cl2N4OS2 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-methylpyridine-2-carboxamide |
| SMILES | Cc1cccc(C(=O)Nc2nnc(SCc3c(Cl)cccc3Cl)s2)n1 |
| InChI | InChI=1S/C16H12Cl2N4OS2/c1-9-4-2-7-13(19-9)14(23)20-15-21-22-16(25-15)24-8-10-11(17)5-3-6-12(10)18/h2-7H,8H2,1H3,(H,20,21,23) |
| InChIKey | GYDBGRIVZYYXFJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|