C22H16Cl2N4OS2 — CID 4042907
N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxamide (PubChem CID 4042907) has the molecular formula C22H16Cl2N4OS2 and a molecular weight of 487.44 g/mol. Its IUPAC name is N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxamide.
| Compound Name | N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 4042907 |
| Molecular Formula | C22H16Cl2N4OS2 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2c(Cl)cccc2Cl)s1)c1c2c(nc3ccccc13)CCC2 |
| InChI | InChI=1S/C22H16Cl2N4OS2/c23-15-7-4-8-16(24)14(15)11-30-22-28-27-21(31-22)26-20(29)19-12-5-1-2-9-17(12)25-18-10-3-6-13(18)19/h1-2,4-5,7-9H,3,6,10-11H2,(H,26,27,29) |
| InChIKey | ZTZHVVDKUPHDCH-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|