C21H15Cl2N5O2S2 — CID 2114069
1-benzyl-N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-oxopyridazine-3-carboxamide (PubChem CID 2114069) has the molecular formula C21H15Cl2N5O2S2 and a molecular weight of 504.42 g/mol. Its IUPAC name is 1-benzyl-N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-benzyl-N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 2114069 |
| Molecular Formula | C21H15Cl2N5O2S2 |
| Molecular Weight | 504.42 g/mol |
| Exact Mass | 503.00 |
| IUPAC Name | 1-benzyl-N-[5-[(2,6-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-oxopyridazine-3-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2c(Cl)cccc2Cl)s1)c1ccc(=O)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C21H15Cl2N5O2S2/c22-15-7-4-8-16(23)14(15)12-31-21-26-25-20(32-21)24-19(30)17-9-10-18(29)28(27-17)11-13-5-2-1-3-6-13/h1-10H,11-12H2,(H,24,25,30) |
| InChIKey | KDLUPTMDAGSYBX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|