C21H16FN5O2S2 — CID 2466506
1-benzyl-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-oxopyridazine-3-carboxamide (PubChem CID 2466506) has the molecular formula C21H16FN5O2S2 and a molecular weight of 453.52 g/mol. Its IUPAC name is 1-benzyl-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-benzyl-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 2466506 |
| Molecular Formula | C21H16FN5O2S2 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 1-benzyl-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-6-oxopyridazine-3-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccc(F)cc2)s1)c1ccc(=O)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C21H16FN5O2S2/c22-16-8-6-15(7-9-16)13-30-21-25-24-20(31-21)23-19(29)17-10-11-18(28)27(26-17)12-14-4-2-1-3-5-14/h1-11H,12-13H2,(H,23,24,29) |
| InChIKey | WPMLKGHECRKORS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|