C14H11FN4O2S2 — CID 17421080
N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 17421080) has the molecular formula C14H11FN4O2S2 and a molecular weight of 350.40 g/mol. Its IUPAC name is N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 17421080 |
| Molecular Formula | C14H11FN4O2S2 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2nnc(SCc3ccc(F)cc3)s2)no1 |
| InChI | InChI=1S/C14H11FN4O2S2/c1-8-6-11(19-21-8)12(20)16-13-17-18-14(23-13)22-7-9-2-4-10(15)5-3-9/h2-6H,7H2,1H3,(H,16,17,20) |
| InChIKey | SBCFFARYOIJJAB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|