C20H18FN5O3S2 — CID 2542260
3,5-diacetamido-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 2542260) has the molecular formula C20H18FN5O3S2 and a molecular weight of 459.53 g/mol. Its IUPAC name is 3,5-diacetamido-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3,5-diacetamido-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 2542260 |
| Molecular Formula | C20H18FN5O3S2 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 3,5-diacetamido-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CC(=O)Nc1cc(NC(C)=O)cc(C(=O)Nc2nnc(SCc3ccc(F)cc3)s2)c1 |
| InChI | InChI=1S/C20H18FN5O3S2/c1-11(27)22-16-7-14(8-17(9-16)23-12(2)28)18(29)24-19-25-26-20(31-19)30-10-13-3-5-15(21)6-4-13/h3-9H,10H2,1-2H3,(H,22,27)(H,23,28)(H,24,25,29) |
| InChIKey | QVBLRNIHVQDHEC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|