C14H12FN5OS3 — CID 30582501
4-ethyl-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]thiadiazole-5-carboxamide (PubChem CID 30582501) has the molecular formula C14H12FN5OS3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-ethyl-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]thiadiazole-5-carboxamide.
| Compound Name | 4-ethyl-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 30582501 |
| Molecular Formula | C14H12FN5OS3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 4-ethyl-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]thiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1nnc(SCc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C14H12FN5OS3/c1-2-10-11(24-20-17-10)12(21)16-13-18-19-14(23-13)22-7-8-3-5-9(15)6-4-8/h3-6H,2,7H2,1H3,(H,16,18,21) |
| InChIKey | LKNRZDFYJMFQIM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|