C15H16FN3O3S2 — CID 40636660
ethyl 4-[[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]amino]-4-oxobutanoate (PubChem CID 40636660) has the molecular formula C15H16FN3O3S2 and a molecular weight of 369.44 g/mol. Its IUPAC name is ethyl 4-[[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 40636660 |
| Molecular Formula | C15H16FN3O3S2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | ethyl 4-[[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1nnc(SCc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C15H16FN3O3S2/c1-2-22-13(21)8-7-12(20)17-14-18-19-15(24-14)23-9-10-3-5-11(16)6-4-10/h3-6H,2,7-9H2,1H3,(H,17,18,20) |
| InChIKey | RQXCOYBJSFLVHX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|