C20H20FN3O3S2 — CID 26694133
3-(3,5-dimethoxyphenyl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 26694133) has the molecular formula C20H20FN3O3S2 and a molecular weight of 433.53 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 3-(3,5-dimethoxyphenyl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 26694133 |
| Molecular Formula | C20H20FN3O3S2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | COc1cc(CCC(=O)Nc2nnc(SCc3ccc(F)cc3)s2)cc(OC)c1 |
| InChI | InChI=1S/C20H20FN3O3S2/c1-26-16-9-14(10-17(11-16)27-2)5-8-18(25)22-19-23-24-20(29-19)28-12-13-3-6-15(21)7-4-13/h3-4,6-7,9-11H,5,8,12H2,1-2H3,(H,22,23,25) |
| InChIKey | NDKJFCOVOYYSQA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|