C15H18FN3OS2 — CID 100527445
3-(4-fluorophenyl)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 100527445) has the molecular formula C15H18FN3OS2 and a molecular weight of 339.46 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 3-(4-fluorophenyl)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 100527445 |
| Molecular Formula | C15H18FN3OS2 |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CC(C)CSc1nnc(NC(=O)CCc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C15H18FN3OS2/c1-10(2)9-21-15-19-18-14(22-15)17-13(20)8-5-11-3-6-12(16)7-4-11/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,17,18,20) |
| InChIKey | JFDSLTHYBSPMRR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|