C16H19FN4O2S2 — CID 40691124
N-[5-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-methylbutanamide (PubChem CID 40691124) has the molecular formula C16H19FN4O2S2 and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[5-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-methylbutanamide.
| Compound Name | N-[5-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 40691124 |
| Molecular Formula | C16H19FN4O2S2 |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[5-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1nnc(SCC(=O)NCc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C16H19FN4O2S2/c1-10(2)7-13(22)19-15-20-21-16(25-15)24-9-14(23)18-8-11-3-5-12(17)6-4-11/h3-6,10H,7-9H2,1-2H3,(H,18,23)(H,19,20,22) |
| InChIKey | VEIHAOAVOKZSAZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|