C21H21FN4O4S2 — CID 42448358
2-(3,4-dimethoxyphenyl)-N-[5-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 42448358) has the molecular formula C21H21FN4O4S2 and a molecular weight of 476.56 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[5-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[5-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 42448358 |
| Molecular Formula | C21H21FN4O4S2 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[5-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2nnc(SCC(=O)NCc3ccc(F)cc3)s2)cc1OC |
| InChI | InChI=1S/C21H21FN4O4S2/c1-29-16-8-5-14(9-17(16)30-2)10-18(27)24-20-25-26-21(32-20)31-12-19(28)23-11-13-3-6-15(22)7-4-13/h3-9H,10-12H2,1-2H3,(H,23,28)(H,24,25,27) |
| InChIKey | UGGYODCRGVLUJA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|