C20H19FN4O4S2 — CID 23732255
2-(3,4-dimethoxyphenyl)-N-[5-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 23732255) has the molecular formula C20H19FN4O4S2 and a molecular weight of 462.53 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[5-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[5-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 23732255 |
| Molecular Formula | C20H19FN4O4S2 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[5-[2-(2-fluoroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2nnc(SCC(=O)Nc3ccccc3F)s2)cc1OC |
| InChI | InChI=1S/C20H19FN4O4S2/c1-28-15-8-7-12(9-16(15)29-2)10-17(26)23-19-24-25-20(31-19)30-11-18(27)22-14-6-4-3-5-13(14)21/h3-9H,10-11H2,1-2H3,(H,22,27)(H,23,24,26) |
| InChIKey | XEMKKTBPFMQUFA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|