C19H18FN3O3S2 — CID 24505878
3-(4-acetyl-5-methylfuran-2-yl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 24505878) has the molecular formula C19H18FN3O3S2 and a molecular weight of 419.50 g/mol. Its IUPAC name is 3-(4-acetyl-5-methylfuran-2-yl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 3-(4-acetyl-5-methylfuran-2-yl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 24505878 |
| Molecular Formula | C19H18FN3O3S2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 3-(4-acetyl-5-methylfuran-2-yl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CC(=O)c1cc(CCC(=O)Nc2nnc(SCc3ccc(F)cc3)s2)oc1C |
| InChI | InChI=1S/C19H18FN3O3S2/c1-11(24)16-9-15(26-12(16)2)7-8-17(25)21-18-22-23-19(28-18)27-10-13-3-5-14(20)6-4-13/h3-6,9H,7-8,10H2,1-2H3,(H,21,22,25) |
| InChIKey | PEMRMUFDHZHIQF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|