C19H17F2N3O2S2 — CID 1252669
(2S)-2-(4-fluorophenoxy)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 1252669) has the molecular formula C19H17F2N3O2S2 and a molecular weight of 421.49 g/mol. Its IUPAC name is (2S)-2-(4-fluorophenoxy)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | (2S)-2-(4-fluorophenoxy)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 1252669 |
| Molecular Formula | C19H17F2N3O2S2 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | (2S)-2-(4-fluorophenoxy)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | CC[C@H](Oc1ccc(F)cc1)C(=O)Nc1nnc(SCc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C19H17F2N3O2S2/c1-2-16(26-15-9-7-14(21)8-10-15)17(25)22-18-23-24-19(28-18)27-11-12-3-5-13(20)6-4-12/h3-10,16H,2,11H2,1H3,(H,22,23,25)/t16-/m0/s1 |
| InChIKey | FORWQXARMRTJGX-INIZCTEOSA-N |
| XLogP | 4.90 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|