C19H17ClFN3O2S2 — CID 18864548
N-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(4-fluorophenoxy)butanamide (PubChem CID 18864548) has the molecular formula C19H17ClFN3O2S2 and a molecular weight of 437.95 g/mol. Its IUPAC name is N-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(4-fluorophenoxy)butanamide.
| Compound Name | N-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 18864548 |
| Molecular Formula | C19H17ClFN3O2S2 |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | N-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(4-fluorophenoxy)butanamide |
| SMILES | CCC(Oc1ccc(F)cc1)C(=O)Nc1nnc(SCc2ccccc2Cl)s1 |
| InChI | InChI=1S/C19H17ClFN3O2S2/c1-2-16(26-14-9-7-13(21)8-10-14)17(25)22-18-23-24-19(28-18)27-11-12-5-3-4-6-15(12)20/h3-10,16H,2,11H2,1H3,(H,22,23,25) |
| InChIKey | YQAJCNXQXOYPOL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|