C13H14ClN3O2S2 — CID 133160961
2-(2-chlorophenoxy)-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 133160961) has the molecular formula C13H14ClN3O2S2 and a molecular weight of 343.86 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 2-(2-chlorophenoxy)-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 133160961 |
| Molecular Formula | C13H14ClN3O2S2 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CCC(Oc1ccccc1Cl)C(=O)Nc1nnc(SC)s1 |
| InChI | InChI=1S/C13H14ClN3O2S2/c1-3-9(19-10-7-5-4-6-8(10)14)11(18)15-12-16-17-13(20-2)21-12/h4-7,9H,3H2,1-2H3,(H,15,16,18) |
| InChIKey | HJEGCRZUGYBZHR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|