C14H16FN3O2S — CID 17013028
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(2-fluorophenoxy)butanamide (PubChem CID 17013028) has the molecular formula C14H16FN3O2S and a molecular weight of 309.37 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(2-fluorophenoxy)butanamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(2-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 17013028 |
| Molecular Formula | C14H16FN3O2S |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(2-fluorophenoxy)butanamide |
| SMILES | CCc1nnc(NC(=O)C(CC)Oc2ccccc2F)s1 |
| InChI | InChI=1S/C14H16FN3O2S/c1-3-10(20-11-8-6-5-7-9(11)15)13(19)16-14-18-17-12(4-2)21-14/h5-8,10H,3-4H2,1-2H3,(H,16,18,19) |
| InChIKey | YRNAFNOHZHHLID-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |