C17H23N3O2S2 — CID 100724473
(2S)-2-(4-methylphenoxy)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 100724473) has the molecular formula C17H23N3O2S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (2S)-2-(4-methylphenoxy)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | (2S)-2-(4-methylphenoxy)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 100724473 |
| Molecular Formula | C17H23N3O2S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | (2S)-2-(4-methylphenoxy)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | CC[C@H](Oc1ccc(C)cc1)C(=O)Nc1nnc(SCC(C)C)s1 |
| InChI | InChI=1S/C17H23N3O2S2/c1-5-14(22-13-8-6-12(4)7-9-13)15(21)18-16-19-20-17(24-16)23-10-11(2)3/h6-9,11,14H,5,10H2,1-4H3,(H,18,19,21)/t14-/m0/s1 |
| InChIKey | KJDRGZVMVGITGL-AWEZNQCLSA-N |
| XLogP | 4.39 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|