C20H27N3O2S2 — CID 100722587
(2S)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide (PubChem CID 100722587) has the molecular formula C20H27N3O2S2 and a molecular weight of 405.59 g/mol. Its IUPAC name is (2S)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide.
| Compound Name | (2S)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
|---|---|
| PubChem CID | 100722587 |
| Molecular Formula | C20H27N3O2S2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (2S)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanamide |
| SMILES | CC[C@H](Oc1ccc2c(c1)CCCC2)C(=O)Nc1nnc(SCC(C)C)s1 |
| InChI | InChI=1S/C20H27N3O2S2/c1-4-17(25-16-10-9-14-7-5-6-8-15(14)11-16)18(24)21-19-22-23-20(27-19)26-12-13(2)3/h9-11,13,17H,4-8,12H2,1-3H3,(H,21,22,24)/t17-/m0/s1 |
| InChIKey | LKOAZNYRPZVYRP-KRWDZBQOSA-N |
| XLogP | 4.96 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|