C18H25N3O2S2 — CID 100584148
(2S)-2-(2,5-dimethylphenoxy)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 100584148) has the molecular formula C18H25N3O2S2 and a molecular weight of 379.55 g/mol. Its IUPAC name is (2S)-2-(2,5-dimethylphenoxy)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | (2S)-2-(2,5-dimethylphenoxy)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 100584148 |
| Molecular Formula | C18H25N3O2S2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (2S)-2-(2,5-dimethylphenoxy)-N-[5-(2-methylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | CC[C@H](Oc1cc(C)ccc1C)C(=O)Nc1nnc(SCC(C)C)s1 |
| InChI | InChI=1S/C18H25N3O2S2/c1-6-14(23-15-9-12(4)7-8-13(15)5)16(22)19-17-20-21-18(25-17)24-10-11(2)3/h7-9,11,14H,6,10H2,1-5H3,(H,19,20,22)/t14-/m0/s1 |
| InChIKey | MWIJDBWOMAXTIU-AWEZNQCLSA-N |
| XLogP | 4.70 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|