C13H17N5OS3 — CID 171343250
N-[5-(cyclopentylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-4-ethylthiadiazole-5-carboxamide (PubChem CID 171343250) has the molecular formula C13H17N5OS3 and a molecular weight of 355.51 g/mol. Its IUPAC name is N-[5-(cyclopentylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-4-ethylthiadiazole-5-carboxamide.
| Compound Name | N-[5-(cyclopentylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-4-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 171343250 |
| Molecular Formula | C13H17N5OS3 |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | N-[5-(cyclopentylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)Nc1nnc(SCC2CCCC2)s1 |
| InChI | InChI=1S/C13H17N5OS3/c1-2-9-10(22-18-15-9)11(19)14-12-16-17-13(21-12)20-7-8-5-3-4-6-8/h8H,2-7H2,1H3,(H,14,16,19) |
| InChIKey | FSKVBJQEJOORSI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|