C10H13N5OS3 — CID 121029144
N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methylthiadiazole-5-carboxamide (PubChem CID 121029144) has the molecular formula C10H13N5OS3 and a molecular weight of 315.45 g/mol. Its IUPAC name is N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 121029144 |
| Molecular Formula | C10H13N5OS3 |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-4-methylthiadiazole-5-carboxamide |
| SMILES | CCCCSc1nnc(NC(=O)c2snnc2C)s1 |
| InChI | InChI=1S/C10H13N5OS3/c1-3-4-5-17-10-14-13-9(18-10)11-8(16)7-6(2)12-15-19-7/h3-5H2,1-2H3,(H,11,13,16) |
| InChIKey | LRJQAFWVKPVYTQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|