C21H18N4O3S2 — CID 19228448
N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 19228448) has the molecular formula C21H18N4O3S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 19228448 |
| Molecular Formula | C21H18N4O3S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | CCCCSc1nnc(NC(=O)c2ccc(N3C(=O)c4ccccc4C3=O)cc2)s1 |
| InChI | InChI=1S/C21H18N4O3S2/c1-2-3-12-29-21-24-23-20(30-21)22-17(26)13-8-10-14(11-9-13)25-18(27)15-6-4-5-7-16(15)19(25)28/h4-11H,2-3,12H2,1H3,(H,22,23,26) |
| InChIKey | BBGAZJMPXFJEFY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|