C15H19N3OS3 — CID 40827786
2-benzylsulfanyl-N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 40827786) has the molecular formula C15H19N3OS3 and a molecular weight of 353.54 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-benzylsulfanyl-N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 40827786 |
| Molecular Formula | C15H19N3OS3 |
| Molecular Weight | 353.54 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-benzylsulfanyl-N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCCSc1nnc(NC(=O)CSCc2ccccc2)s1 |
| InChI | InChI=1S/C15H19N3OS3/c1-2-3-9-21-15-18-17-14(22-15)16-13(19)11-20-10-12-7-5-4-6-8-12/h4-8H,2-3,9-11H2,1H3,(H,16,17,19) |
| InChIKey | PQPUMXLHTXQZEK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|