C12H21N3OS2 — CID 19228550
N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-3,3-dimethylbutanamide (PubChem CID 19228550) has the molecular formula C12H21N3OS2 and a molecular weight of 287.45 g/mol. Its IUPAC name is N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-3,3-dimethylbutanamide.
| Compound Name | N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 19228550 |
| Molecular Formula | C12H21N3OS2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-3,3-dimethylbutanamide |
| SMILES | CCCCSc1nnc(NC(=O)CC(C)(C)C)s1 |
| InChI | InChI=1S/C12H21N3OS2/c1-5-6-7-17-11-15-14-10(18-11)13-9(16)8-12(2,3)4/h5-8H2,1-4H3,(H,13,14,16) |
| InChIKey | BYDKFMUHOKNPEE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|