C14H23N3O3S2 — CID 42805496
ethyl 4-[[5-(3,3-dimethylbutanoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanoate (PubChem CID 42805496) has the molecular formula C14H23N3O3S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is ethyl 4-[[5-(3,3-dimethylbutanoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanoate.
| Compound Name | ethyl 4-[[5-(3,3-dimethylbutanoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanoate |
|---|---|
| PubChem CID | 42805496 |
| Molecular Formula | C14H23N3O3S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | ethyl 4-[[5-(3,3-dimethylbutanoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanoate |
| SMILES | CCOC(=O)CCCSc1nnc(NC(=O)CC(C)(C)C)s1 |
| InChI | InChI=1S/C14H23N3O3S2/c1-5-20-11(19)7-6-8-21-13-17-16-12(22-13)15-10(18)9-14(2,3)4/h5-9H2,1-4H3,(H,15,16,18) |
| InChIKey | KPLKCTBCPRZIAU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|