C13H22N4O3S2 — CID 16516201
ethyl 4-[[2-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]butanoate (PubChem CID 16516201) has the molecular formula C13H22N4O3S2 and a molecular weight of 346.48 g/mol. Its IUPAC name is ethyl 4-[[2-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 16516201 |
| Molecular Formula | C13H22N4O3S2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | ethyl 4-[[2-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CSc1nnc(NC(C)C)s1 |
| InChI | InChI=1S/C13H22N4O3S2/c1-4-20-11(19)6-5-7-14-10(18)8-21-13-17-16-12(22-13)15-9(2)3/h9H,4-8H2,1-3H3,(H,14,18)(H,15,16) |
| InChIKey | DVFMABDVNJFZMG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|