C17H22N4O3S2 — CID 2409241
ethyl 4-[[2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]butanoate (PubChem CID 2409241) has the molecular formula C17H22N4O3S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is ethyl 4-[[2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 2409241 |
| Molecular Formula | C17H22N4O3S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | ethyl 4-[[2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CSc1nnc(Nc2cccc(C)c2)s1 |
| InChI | InChI=1S/C17H22N4O3S2/c1-3-24-15(23)8-5-9-18-14(22)11-25-17-21-20-16(26-17)19-13-7-4-6-12(2)10-13/h4,6-7,10H,3,5,8-9,11H2,1-2H3,(H,18,22)(H,19,20) |
| InChIKey | DNTQJOVRZDOGSW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|