C20H22N4O2S2 — CID 40739118
2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[2-(3-methylphenoxy)ethyl]acetamide (PubChem CID 40739118) has the molecular formula C20H22N4O2S2 and a molecular weight of 414.56 g/mol. Its IUPAC name is 2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[2-(3-methylphenoxy)ethyl]acetamide.
| Compound Name | 2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[2-(3-methylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 40739118 |
| Molecular Formula | C20H22N4O2S2 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-[[5-(3-methylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[2-(3-methylphenoxy)ethyl]acetamide |
| SMILES | Cc1cccc(Nc2nnc(SCC(=O)NCCOc3cccc(C)c3)s2)c1 |
| InChI | InChI=1S/C20H22N4O2S2/c1-14-5-3-7-16(11-14)22-19-23-24-20(28-19)27-13-18(25)21-9-10-26-17-8-4-6-15(2)12-17/h3-8,11-12H,9-10,13H2,1-2H3,(H,21,25)(H,22,23) |
| InChIKey | HVGLAVZFGJDRJB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|