C10H15N3O3S2 — CID 61285334
2-[[5-(3,3-dimethylbutanoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 61285334) has the molecular formula C10H15N3O3S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-[[5-(3,3-dimethylbutanoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-(3,3-dimethylbutanoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 61285334 |
| Molecular Formula | C10H15N3O3S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-[[5-(3,3-dimethylbutanoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
| SMILES | CC(C)(C)CC(=O)Nc1nnc(SCC(=O)O)s1 |
| InChI | InChI=1S/C10H15N3O3S2/c1-10(2,3)4-6(14)11-8-12-13-9(18-8)17-5-7(15)16/h4-5H2,1-3H3,(H,15,16)(H,11,12,14) |
| InChIKey | GLQAYCPNZQQRSY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|