C16H21N3O3S2 — CID 19228480
N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-ethoxyphenoxy)acetamide (PubChem CID 19228480) has the molecular formula C16H21N3O3S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-ethoxyphenoxy)acetamide.
| Compound Name | N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-ethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 19228480 |
| Molecular Formula | C16H21N3O3S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-ethoxyphenoxy)acetamide |
| SMILES | CCCCSc1nnc(NC(=O)COc2ccc(OCC)cc2)s1 |
| InChI | InChI=1S/C16H21N3O3S2/c1-3-5-10-23-16-19-18-15(24-16)17-14(20)11-22-13-8-6-12(7-9-13)21-4-2/h6-9H,3-5,10-11H2,1-2H3,(H,17,18,20) |
| InChIKey | CIXRQVAPFPYCOY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|