C13H14N4O4S2 — CID 19217404
2-(4-nitrophenoxy)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 19217404) has the molecular formula C13H14N4O4S2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(4-nitrophenoxy)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 19217404 |
| Molecular Formula | C13H14N4O4S2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 2-(4-nitrophenoxy)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCSc1nnc(NC(=O)COc2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C13H14N4O4S2/c1-2-7-22-13-16-15-12(23-13)14-11(18)8-21-10-5-3-9(4-6-10)17(19)20/h3-6H,2,7-8H2,1H3,(H,14,15,18) |
| InChIKey | ORIAYUBSSAZCJU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|