C20H16N4O3S2 — CID 19228467
3-(1,3-dioxoisoindol-2-yl)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 19228467) has the molecular formula C20H16N4O3S2 and a molecular weight of 424.51 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 19228467 |
| Molecular Formula | C20H16N4O3S2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCSc1nnc(NC(=O)c2cccc(N3C(=O)c4ccccc4C3=O)c2)s1 |
| InChI | InChI=1S/C20H16N4O3S2/c1-2-10-28-20-23-22-19(29-20)21-16(25)12-6-5-7-13(11-12)24-17(26)14-8-3-4-9-15(14)18(24)27/h3-9,11H,2,10H2,1H3,(H,21,22,25) |
| InChIKey | CFVOHGQJKGCHNY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|