C25H19N5O5S2 — CID 25046005
3-(1,3-dioxoisoindol-2-yl)-N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]benzamide (PubChem CID 25046005) has the molecular formula C25H19N5O5S2 and a molecular weight of 533.59 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]benzamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 25046005 |
| Molecular Formula | C25H19N5O5S2 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]benzamide |
| SMILES | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(N4C(=O)c5ccccc5C4=O)c3)cc2)s1 |
| InChI | InChI=1S/C25H19N5O5S2/c1-2-21-27-28-25(36-21)29-37(34,35)18-12-10-16(11-13-18)26-22(31)15-6-5-7-17(14-15)30-23(32)19-8-3-4-9-20(19)24(30)33/h3-14H,2H2,1H3,(H,26,31)(H,28,29) |
| InChIKey | GXGSYQQURAVJNK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|