C22H24N4O4S2 — CID 50739495
4-cyclopentyloxy-N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]benzamide (PubChem CID 50739495) has the molecular formula C22H24N4O4S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 4-cyclopentyloxy-N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]benzamide.
| Compound Name | 4-cyclopentyloxy-N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 50739495 |
| Molecular Formula | C22H24N4O4S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 4-cyclopentyloxy-N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]benzamide |
| SMILES | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(OC4CCCC4)cc3)cc2)s1 |
| InChI | InChI=1S/C22H24N4O4S2/c1-2-20-24-25-22(31-20)26-32(28,29)19-13-9-16(10-14-19)23-21(27)15-7-11-18(12-8-15)30-17-5-3-4-6-17/h7-14,17H,2-6H2,1H3,(H,23,27)(H,25,26) |
| InChIKey | VFVJUHYTJQOTQK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |