C19H18N4O3S2 — CID 5027269
N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-3-phenylprop-2-enamide (PubChem CID 5027269) has the molecular formula C19H18N4O3S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-3-phenylprop-2-enamide.
| Compound Name | N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 5027269 |
| Molecular Formula | C19H18N4O3S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-3-phenylprop-2-enamide |
| SMILES | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)C=Cc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C19H18N4O3S2/c1-2-18-21-22-19(27-18)23-28(25,26)16-11-9-15(10-12-16)20-17(24)13-8-14-6-4-3-5-7-14/h3-13H,2H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | NBOSTAOGNMECKV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|