C23H25N5O3S3 — CID 2247463
(E)-N-[[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 2247463) has the molecular formula C23H25N5O3S3 and a molecular weight of 515.69 g/mol. Its IUPAC name is (E)-N-[[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2247463 |
| Molecular Formula | C23H25N5O3S3 |
| Molecular Weight | 515.69 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | (E)-N-[[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]carbamothioyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CCc1nnc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)/C=C/c3ccc(C(C)C)cc3)cc2)s1 |
| InChI | InChI=1S/C23H25N5O3S3/c1-4-21-26-27-23(33-21)28-34(30,31)19-12-10-18(11-13-19)24-22(32)25-20(29)14-7-16-5-8-17(9-6-16)15(2)3/h5-15H,4H2,1-3H3,(H,27,28)(H2,24,25,29,32)/b14-7+ |
| InChIKey | IMLRWXNCJUEBEP-VGOFMYFVSA-N |
| XLogP | 4.55 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.69 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|