C15H16N4OS2 — CID 54787180
(E)-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 54787180) has the molecular formula C15H16N4OS2 and a molecular weight of 332.45 g/mol. Its IUPAC name is (E)-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 54787180 |
| Molecular Formula | C15H16N4OS2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | (E)-N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | CCc1nnc(NC(=S)NC(=O)/C=C/c2ccc(C)cc2)s1 |
| InChI | InChI=1S/C15H16N4OS2/c1-3-13-18-19-15(22-13)17-14(21)16-12(20)9-8-11-6-4-10(2)5-7-11/h4-9H,3H2,1-2H3,(H2,16,17,19,20,21)/b9-8+ |
| InChIKey | LRGQREMCNVLOCH-CMDGGOBGSA-N |
| XLogP | 2.94 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|