C24H25N5O4S2 — CID 17227386
(E)-N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]-3-(4-ethoxyphenyl)prop-2-enamide (PubChem CID 17227386) has the molecular formula C24H25N5O4S2 and a molecular weight of 511.63 g/mol. Its IUPAC name is (E)-N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]-3-(4-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]-3-(4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17227386 |
| Molecular Formula | C24H25N5O4S2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | (E)-N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]-3-(4-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3nc(C)cc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C24H25N5O4S2/c1-4-33-20-10-5-18(6-11-20)7-14-22(30)28-24(34)27-19-8-12-21(13-9-19)35(31,32)29-23-25-16(2)15-17(3)26-23/h5-15H,4H2,1-3H3,(H,25,26,29)(H2,27,28,30,34)/b14-7+ |
| InChIKey | IXRVWOGUSIWZCO-VGOFMYFVSA-N |
| XLogP | 3.82 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|