C25H25N3O6S2 — CID 4659269
3-(3,4-dimethoxyphenyl)-N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide (PubChem CID 4659269) has the molecular formula C25H25N3O6S2 and a molecular weight of 527.62 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 4659269 |
| Molecular Formula | C25H25N3O6S2 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)C=Cc3ccc(OC)c(OC)c3)cc2)cc1 |
| InChI | InChI=1S/C25H25N3O6S2/c1-32-20-10-6-19(7-11-20)28-36(30,31)21-12-8-18(9-13-21)26-25(35)27-24(29)15-5-17-4-14-22(33-2)23(16-17)34-3/h4-16,28H,1-3H3,(H2,26,27,29,35) |
| InChIKey | ZQFOEKRNGWVLBV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|