C19H20N4O6S2 — CID 2255880
(Z)-N-[[4-(carbamoylsulfamoyl)phenyl]carbamothioyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 2255880) has the molecular formula C19H20N4O6S2 and a molecular weight of 464.53 g/mol. Its IUPAC name is (Z)-N-[[4-(carbamoylsulfamoyl)phenyl]carbamothioyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-N-[[4-(carbamoylsulfamoyl)phenyl]carbamothioyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2255880 |
| Molecular Formula | C19H20N4O6S2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | (Z)-N-[[4-(carbamoylsulfamoyl)phenyl]carbamothioyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C\C(=O)NC(=S)Nc2ccc(S(=O)(=O)NC(N)=O)cc2)cc1OC |
| InChI | InChI=1S/C19H20N4O6S2/c1-28-15-9-3-12(11-16(15)29-2)4-10-17(24)22-19(30)21-13-5-7-14(8-6-13)31(26,27)23-18(20)25/h3-11H,1-2H3,(H3,20,23,25)(H2,21,22,24,30)/b10-4- |
| InChIKey | DWBYAGPXONCJQB-WMZJFQQLSA-N |
| XLogP | 1.59 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|