C24H29N3O5S2 — CID 6308594
(E)-3-(3,4-dimethoxyphenyl)-N-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]carbamothioyl]prop-2-enamide (PubChem CID 6308594) has the molecular formula C24H29N3O5S2 and a molecular weight of 503.65 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 6308594 |
| Molecular Formula | C24H29N3O5S2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]carbamothioyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(=S)Nc2ccc(S(=O)(=O)N3CCC(C)CC3)cc2)cc1OC |
| InChI | InChI=1S/C24H29N3O5S2/c1-17-12-14-27(15-13-17)34(29,30)20-8-6-19(7-9-20)25-24(33)26-23(28)11-5-18-4-10-21(31-2)22(16-18)32-3/h4-11,16-17H,12-15H2,1-3H3,(H2,25,26,28,33)/b11-5+ |
| InChIKey | YEGLOHNFJLRUJY-VZUCSPMQSA-N |
| XLogP | 3.65 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|