C26H27N3O5S2 — CID 4659267
3-(3,4-dimethoxyphenyl)-N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide (PubChem CID 4659267) has the molecular formula C26H27N3O5S2 and a molecular weight of 525.65 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 4659267 |
| Molecular Formula | C26H27N3O5S2 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3cc(C)cc(C)c3)cc2)cc1OC |
| InChI | InChI=1S/C26H27N3O5S2/c1-17-13-18(2)15-21(14-17)29-36(31,32)22-9-7-20(8-10-22)27-26(35)28-25(30)12-6-19-5-11-23(33-3)24(16-19)34-4/h5-16,29H,1-4H3,(H2,27,28,30,35) |
| InChIKey | KRBOIJBRYHTING-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|