C24H25N5O5S2 — CID 3095035
3-(3,4-dimethoxyphenyl)-N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide (PubChem CID 3095035) has the molecular formula C24H25N5O5S2 and a molecular weight of 527.63 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3095035 |
| Molecular Formula | C24H25N5O5S2 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3nc(C)cc(C)n3)cc2)cc1OC |
| InChI | InChI=1S/C24H25N5O5S2/c1-15-13-16(2)26-23(25-15)29-36(31,32)19-9-7-18(8-10-19)27-24(35)28-22(30)12-6-17-5-11-20(33-3)21(14-17)34-4/h5-14H,1-4H3,(H,25,26,29)(H2,27,28,30,35) |
| InChIKey | VIAKJLFNJZFSGV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|