C24H24N4O3S2 — CID 162220610
(E)-N-[[4-[(4,6-dimethylpyrimidin-2-yl)methylsulfonyl]phenyl]carbamothioyl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 162220610) has the molecular formula C24H24N4O3S2 and a molecular weight of 480.62 g/mol. Its IUPAC name is (E)-N-[[4-[(4,6-dimethylpyrimidin-2-yl)methylsulfonyl]phenyl]carbamothioyl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[4-[(4,6-dimethylpyrimidin-2-yl)methylsulfonyl]phenyl]carbamothioyl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 162220610 |
| Molecular Formula | C24H24N4O3S2 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | (E)-N-[[4-[(4,6-dimethylpyrimidin-2-yl)methylsulfonyl]phenyl]carbamothioyl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)NC(=S)Nc2ccc(S(=O)(=O)Cc3nc(C)cc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C24H24N4O3S2/c1-16-4-6-19(7-5-16)8-13-23(29)28-24(32)27-20-9-11-21(12-10-20)33(30,31)15-22-25-17(2)14-18(3)26-22/h4-14H,15H2,1-3H3,(H2,27,28,29,32)/b13-8+ |
| InChIKey | ZUBLJEZKGPNSKG-MDWZMJQESA-N |
| XLogP | 3.90 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|