C19H21N3O3S2 — CID 4932903
3-phenyl-N-[[4-(propylsulfamoyl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 4932903) has the molecular formula C19H21N3O3S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 3-phenyl-N-[[4-(propylsulfamoyl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-phenyl-N-[[4-(propylsulfamoyl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 4932903 |
| Molecular Formula | C19H21N3O3S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 3-phenyl-N-[[4-(propylsulfamoyl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | CCCNS(=O)(=O)c1ccc(NC(=S)NC(=O)C=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C19H21N3O3S2/c1-2-14-20-27(24,25)17-11-9-16(10-12-17)21-19(26)22-18(23)13-8-15-6-4-3-5-7-15/h3-13,20H,2,14H2,1H3,(H2,21,22,23,26) |
| InChIKey | LBPPGHXAIJZHCT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|