C22H18N4O5S2 — CID 17187106
(E)-3-(4-nitrophenyl)-N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 17187106) has the molecular formula C22H18N4O5S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is (E)-3-(4-nitrophenyl)-N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(4-nitrophenyl)-N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17187106 |
| Molecular Formula | C22H18N4O5S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | (E)-3-(4-nitrophenyl)-N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NC(=S)Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H18N4O5S2/c27-21(15-8-16-6-11-19(12-7-16)26(28)29)24-22(32)23-17-9-13-20(14-10-17)33(30,31)25-18-4-2-1-3-5-18/h1-15,25H,(H2,23,24,27,32)/b15-8+ |
| InChIKey | VDAOGBLUWOAVQM-OVCLIPMQSA-N |
| XLogP | 3.92 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|